About 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine
7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine (PubChem CID 66923381) has the molecular formula C17H14ClF3N2O2
and a molecular weight of 370.76 g/mol. Its IUPAC name is 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine.
Molecular Properties
| Compound Name | 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine |
| PubChem CID | 66923381 |
| Molecular Formula | C17H14ClF3N2O2 |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine |
| SMILES | C=CC1(C(F)(F)F)OCC(=O)Nc2ccc(Cl)cc21.c1ccncc1 |
| InChI | InChI=1S/C12H9ClF3NO2.C5H5N/c1-2-11(12(14,15)16)8-5-7(13)3-4-9(8)17-10(18)6-19-11;1-2-4-6-5-3-1/h2-5H,1,6H2,(H,17,18);1-5H |
| InChIKey | DNPUGTOIDVRQKL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine?
The IUPAC name of 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine (CID 66923381) is 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine.
What is the SMILES notation for 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine?
The canonical SMILES for 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine is C=CC1(C(F)(F)F)OCC(=O)Nc2ccc(Cl)cc21.c1ccncc1.
What is the InChIKey of 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine?
The InChIKey is DNPUGTOIDVRQKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF3NO2.C5H5N/c1-2-11(12(14,15)16)8-5-7(13)3-4-9(8)17-10(18)6-19-11;1-2-4-6-5-3-1/h2-5H,1,6H2,(H,17,18);1-5H.
What are the key properties of 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine?
7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine has a molecular weight of 370.76 g/mol, XLogP of 4.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-ethenyl-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one;pyridine is sourced from PubChem (CID 66923381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).