C17H32N2O4 — CID 66923528
1-N',1-N'-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 66923528) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is 1-N',1-N'-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923528 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 1-N',1-N'-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | CC(C)(C)[C@@H](CO)N(C(=O)C1(C(N)=O)CC1)[C@H](CO)C(C)(C)C |
| InChI | InChI=1S/C17H32N2O4/c1-15(2,3)11(9-20)19(12(10-21)16(4,5)6)14(23)17(7-8-17)13(18)22/h11-12,20-21H,7-10H2,1-6H3,(H2,18,22)/t11-,12-/m1/s1 |
| InChIKey | VUJLVYZLLMNWOC-VXGBXAGGSA-N |
| XLogP | 0.89 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|