About 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid
2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid (PubChem CID 66923844) has the molecular formula C13H18O6
and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid.
Molecular Properties
| Compound Name | 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid |
| PubChem CID | 66923844 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1(OCCO)C=CC(OCCO)=CC1 |
| InChI | InChI=1S/C13H18O6/c1-10(12(16)17)13(19-9-7-15)4-2-11(3-5-13)18-8-6-14/h2-4,14-15H,1,5-9H2,(H,16,17) |
| InChIKey | FKFGBUXJHAVTRG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid?
The IUPAC name of 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid (CID 66923844) is 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid.
What is the SMILES notation for 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid?
The canonical SMILES for 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid is C=C(C(=O)O)C1(OCCO)C=CC(OCCO)=CC1.
What is the InChIKey of 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid?
The InChIKey is FKFGBUXJHAVTRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O6/c1-10(12(16)17)13(19-9-7-15)4-2-11(3-5-13)18-8-6-14/h2-4,14-15H,1,5-9H2,(H,16,17).
What are the key properties of 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid?
2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid has a molecular weight of 270.28 g/mol, XLogP of 0.23, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,4-bis(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid is sourced from PubChem (CID 66923844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).