C19H36N2O4 — CID 66923890
1-N',1-N'-bis[(2R)-1-hydroxy-4-methylpentan-2-yl]cyclopentane-1,1-dicarboxamide (PubChem CID 66923890) has the molecular formula C19H36N2O4 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-N',1-N'-bis[(2R)-1-hydroxy-4-methylpentan-2-yl]cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[(2R)-1-hydroxy-4-methylpentan-2-yl]cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923890 |
| Molecular Formula | C19H36N2O4 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 1-N',1-N'-bis[(2R)-1-hydroxy-4-methylpentan-2-yl]cyclopentane-1,1-dicarboxamide |
| SMILES | CC(C)C[C@H](CO)N(C(=O)C1(C(N)=O)CCCC1)[C@@H](CO)CC(C)C |
| InChI | InChI=1S/C19H36N2O4/c1-13(2)9-15(11-22)21(16(12-23)10-14(3)4)18(25)19(17(20)24)7-5-6-8-19/h13-16,22-23H,5-12H2,1-4H3,(H2,20,24)/t15-,16-/m1/s1 |
| InChIKey | ADDRSXPTHDBHSH-HZPDHXFCSA-N |
| XLogP | 1.67 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|