About 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline
5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline (PubChem CID 66924385) has the molecular formula C19H19ClN2O
and a molecular weight of 326.83 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline.
Molecular Properties
| Compound Name | 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline |
| PubChem CID | 66924385 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline |
| SMILES | CC(C)(C)C(Oc1cccc2ncncc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O/c1-19(2,3)18(13-7-9-14(20)10-8-13)23-17-6-4-5-16-15(17)11-21-12-22-16/h4-12,18H,1-3H3 |
| InChIKey | QEVVKFJACXPCSJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline?
The IUPAC name of 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline (CID 66924385) is 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline.
What is the SMILES notation for 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline?
The canonical SMILES for 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline is CC(C)(C)C(Oc1cccc2ncncc12)c1ccc(Cl)cc1.
What is the InChIKey of 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline?
The InChIKey is QEVVKFJACXPCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN2O/c1-19(2,3)18(13-7-9-14(20)10-8-13)23-17-6-4-5-16-15(17)11-21-12-22-16/h4-12,18H,1-3H3.
What are the key properties of 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline?
5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline has a molecular weight of 326.83 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(4-chlorophenyl)-2,2-dimethylpropoxy]quinazoline is sourced from PubChem (CID 66924385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).