C28H40FN3O5Si — CID 66924447
(2R,5S)-2-tert-butyl-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]-5-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylic acid (PubChem CID 66924447) has the molecular formula C28H40FN3O5Si and a molecular weight of 545.73 g/mol. Its IUPAC name is (2R,5S)-2-tert-butyl-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]-5-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,5S)-2-tert-butyl-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]-5-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66924447 |
| Molecular Formula | C28H40FN3O5Si |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | (2R,5S)-2-tert-butyl-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]-5-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)[C@@]1([C@H](O[Si](C)(C)C(C)(C)C)c2cncc(F)c2)CC[C@@H](Cc2ccc([N+](=O)[O-])cc2)N1C(=O)O |
| InChI | InChI=1S/C28H40FN3O5Si/c1-26(2,3)28(24(20-16-21(29)18-30-17-20)37-38(7,8)27(4,5)6)14-13-23(31(28)25(33)34)15-19-9-11-22(12-10-19)32(35)36/h9-12,16-18,23-24H,13-15H2,1-8H3,(H,33,34)/t23-,24+,28-/m0/s1 |
| InChIKey | SWZDMWBYMAEFKG-JPYHZWLXSA-N |
| XLogP | 7.36 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|