C38H42N4O4 — CID 6692530
3-[1-[[(2R,4R,5S,6S)-2-[3-[3-(aminomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 6692530) has the molecular formula C38H42N4O4 and a molecular weight of 618.78 g/mol. Its IUPAC name is 3-[1-[[(2R,4R,5S,6S)-2-[3-[3-(aminomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[[(2R,4R,5S,6S)-2-[3-[3-(aminomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 6692530 |
| Molecular Formula | C38H42N4O4 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 3-[1-[[(2R,4R,5S,6S)-2-[3-[3-(aminomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | C[C@@H]1[C@H](CN2CCC(n3c(=O)[nH]c4ccccc43)CC2)O[C@H](c2cccc(-c3cccc(CN)c3)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C38H42N4O4/c1-25-35(23-41-18-16-32(17-19-41)42-34-11-3-2-10-33(34)40-38(42)44)45-37(46-36(25)28-14-12-26(24-43)13-15-28)31-9-5-8-30(21-31)29-7-4-6-27(20-29)22-39/h2-15,20-21,25,32,35-37,43H,16-19,22-24,39H2,1H3,(H,40,44)/t25-,35+,36+,37+/m1/s1 |
| InChIKey | XDEDIDGMBOUKAX-LFNJSMFSSA-N |
| XLogP | 6.08 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |