About 4-methyl-4-phenyl-1,4-azasilinane
4-methyl-4-phenyl-1,4-azasilinane (PubChem CID 66925910) has the molecular formula C11H17NSi
and a molecular weight of 191.35 g/mol. Its IUPAC name is 4-methyl-4-phenyl-1,4-azasilinane.
Molecular Properties
| Compound Name | 4-methyl-4-phenyl-1,4-azasilinane |
| PubChem CID | 66925910 |
| Molecular Formula | C11H17NSi |
| Molecular Weight | 191.35 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-methyl-4-phenyl-1,4-azasilinane |
| SMILES | C[Si]1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C11H17NSi/c1-13(9-7-12-8-10-13)11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3 |
| InChIKey | LWNUWNBJMMKFAH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-4-phenyl-1,4-azasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-phenyl-1,4-azasilinane?
The IUPAC name of 4-methyl-4-phenyl-1,4-azasilinane (CID 66925910) is 4-methyl-4-phenyl-1,4-azasilinane.
What is the SMILES notation for 4-methyl-4-phenyl-1,4-azasilinane?
The canonical SMILES for 4-methyl-4-phenyl-1,4-azasilinane is C[Si]1(c2ccccc2)CCNCC1.
What is the InChIKey of 4-methyl-4-phenyl-1,4-azasilinane?
The InChIKey is LWNUWNBJMMKFAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NSi/c1-13(9-7-12-8-10-13)11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3.
What are the key properties of 4-methyl-4-phenyl-1,4-azasilinane?
4-methyl-4-phenyl-1,4-azasilinane has a molecular weight of 191.35 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-phenyl-1,4-azasilinane is sourced from PubChem (CID 66925910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).