C8H11NO — CID 66926021
1,2,3,3a,6,7a-hexahydroindol-7-one (PubChem CID 66926021) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 1,2,3,3a,6,7a-hexahydroindol-7-one.
| Compound Name | 1,2,3,3a,6,7a-hexahydroindol-7-one |
|---|---|
| PubChem CID | 66926021 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1,2,3,3a,6,7a-hexahydroindol-7-one |
| SMILES | O=C1CC=CC2CCNC12 |
| InChI | InChI=1S/C8H11NO/c10-7-3-1-2-6-4-5-9-8(6)7/h1-2,6,8-9H,3-5H2 |
| InChIKey | KWAFFLROSQJOBB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|