About N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide
N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide (PubChem CID 66926041) has the molecular formula C20H21Cl2N3O3S
and a molecular weight of 454.38 g/mol. Its IUPAC name is N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide.
Molecular Properties
| Compound Name | N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide |
| PubChem CID | 66926041 |
| Molecular Formula | C20H21Cl2N3O3S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide |
| SMILES | CCCCS(=O)(=O)NC(=O)c1c(Cc2ccc(Cl)cc2Cl)ccc2[nH]c(C)nc12 |
| InChI | InChI=1S/C20H21Cl2N3O3S/c1-3-4-9-29(27,28)25-20(26)18-14(6-8-17-19(18)24-12(2)23-17)10-13-5-7-15(21)11-16(13)22/h5-8,11H,3-4,9-10H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | WLAMEPCBOVAGDC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide?
The IUPAC name of N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide (CID 66926041) is N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide.
What is the SMILES notation for N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide?
The canonical SMILES for N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide is CCCCS(=O)(=O)NC(=O)c1c(Cc2ccc(Cl)cc2Cl)ccc2[nH]c(C)nc12.
What is the InChIKey of N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide?
The InChIKey is WLAMEPCBOVAGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2N3O3S/c1-3-4-9-29(27,28)25-20(26)18-14(6-8-17-19(18)24-12(2)23-17)10-13-5-7-15(21)11-16(13)22/h5-8,11H,3-4,9-10H2,1-2H3,(H,23,24)(H,25,26).
What are the key properties of N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide?
N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide has a molecular weight of 454.38 g/mol, XLogP of 4.63, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylsulfonyl-5-[(2,4-dichlorophenyl)methyl]-2-methyl-1H-benzimidazole-4-carboxamide is sourced from PubChem (CID 66926041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).