C21H16ClFN2O2S — CID 66926115
2-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-4-[(5-fluoro-2-pyridinyl)methyl]cyclopentane-1,3-dione (PubChem CID 66926115) has the molecular formula C21H16ClFN2O2S and a molecular weight of 414.89 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-4-[(5-fluoro-2-pyridinyl)methyl]cyclopentane-1,3-dione.
| Compound Name | 2-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-4-[(5-fluoro-2-pyridinyl)methyl]cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 66926115 |
| Molecular Formula | C21H16ClFN2O2S |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-4-[(5-fluoro-2-pyridinyl)methyl]cyclopentane-1,3-dione |
| SMILES | Cc1sc(-c2ccc(Cl)cc2)nc1C1C(=O)CC(Cc2ccc(F)cn2)C1=O |
| InChI | InChI=1S/C21H16ClFN2O2S/c1-11-19(25-21(28-11)12-2-4-14(22)5-3-12)18-17(26)9-13(20(18)27)8-16-7-6-15(23)10-24-16/h2-7,10,13,18H,8-9H2,1H3 |
| InChIKey | HECCCBHTMHXDSO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|