C21H20N4O2 — CID 66926236
5-(4-anilinophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one (PubChem CID 66926236) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 5-(4-anilinophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 5-(4-anilinophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 66926236 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 5-(4-anilinophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one |
| SMILES | CCN1Cc2c(Oc3ccc(Nc4ccccc4)cc3)ccnc2NC1=O |
| InChI | InChI=1S/C21H20N4O2/c1-2-25-14-18-19(12-13-22-20(18)24-21(25)26)27-17-10-8-16(9-11-17)23-15-6-4-3-5-7-15/h3-13,23H,2,14H2,1H3,(H,22,24,26) |
| InChIKey | CHKIMTOMVWQACN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |