About [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate
[4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate (PubChem CID 66926922) has the molecular formula C16H19F2NO4
and a molecular weight of 327.33 g/mol. Its IUPAC name is [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate.
Molecular Properties
| Compound Name | [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate |
| PubChem CID | 66926922 |
| Molecular Formula | C16H19F2NO4 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate |
| SMILES | CC(=O)OC1(NC(=O)OCc2ccccc2)CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H19F2NO4/c1-12(20)23-16(9-7-15(17,18)8-10-16)19-14(21)22-11-13-5-3-2-4-6-13/h2-6H,7-11H2,1H3,(H,19,21) |
| InChIKey | XJINCEYFIVHDHW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate?
The IUPAC name of [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate (CID 66926922) is [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate.
What is the SMILES notation for [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate?
The canonical SMILES for [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate is CC(=O)OC1(NC(=O)OCc2ccccc2)CCC(F)(F)CC1.
What is the InChIKey of [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate?
The InChIKey is XJINCEYFIVHDHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2NO4/c1-12(20)23-16(9-7-15(17,18)8-10-16)19-14(21)22-11-13-5-3-2-4-6-13/h2-6H,7-11H2,1H3,(H,19,21).
What are the key properties of [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate?
[4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate has a molecular weight of 327.33 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-difluoro-1-(phenylmethoxycarbonylamino)cyclohexyl] acetate is sourced from PubChem (CID 66926922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).