About carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid
carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid (PubChem CID 66927028) has the molecular formula C16H23N3O6
and a molecular weight of 353.38 g/mol. Its IUPAC name is carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid.
Molecular Properties
| Compound Name | carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid |
| PubChem CID | 66927028 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid |
| SMILES | Cc1c(N(C(=O)O)C(=O)O)nc(C(C)(C)C)c([N+](=O)[O-])c1C(C)(C)C |
| InChI | InChI=1S/C16H23N3O6/c1-8-9(15(2,3)4)10(19(24)25)11(16(5,6)7)17-12(8)18(13(20)21)14(22)23/h1-7H3,(H,20,21)(H,22,23) |
| InChIKey | FBVBNKHECSMIDH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid?
The IUPAC name of carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid (CID 66927028) is carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid.
What is the SMILES notation for carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid?
The canonical SMILES for carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid is Cc1c(N(C(=O)O)C(=O)O)nc(C(C)(C)C)c([N+](=O)[O-])c1C(C)(C)C.
What is the InChIKey of carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid?
The InChIKey is FBVBNKHECSMIDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O6/c1-8-9(15(2,3)4)10(19(24)25)11(16(5,6)7)17-12(8)18(13(20)21)14(22)23/h1-7H3,(H,20,21)(H,22,23).
What are the key properties of carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid?
carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid has a molecular weight of 353.38 g/mol, XLogP of 4.06, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carboxy-(4,6-ditert-butyl-3-methyl-5-nitro-2-pyridinyl)carbamic acid is sourced from PubChem (CID 66927028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).