C17H22N2O3 — CID 66927171
3-[3-[2-(dimethylamino)ethyl]-4-methoxy-1-methylindol-7-yl]prop-2-enoic acid (PubChem CID 66927171) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-[3-[2-(dimethylamino)ethyl]-4-methoxy-1-methylindol-7-yl]prop-2-enoic acid.
| Compound Name | 3-[3-[2-(dimethylamino)ethyl]-4-methoxy-1-methylindol-7-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66927171 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-[3-[2-(dimethylamino)ethyl]-4-methoxy-1-methylindol-7-yl]prop-2-enoic acid |
| SMILES | COc1ccc(C=CC(=O)O)c2c1c(CCN(C)C)cn2C |
| InChI | InChI=1S/C17H22N2O3/c1-18(2)10-9-13-11-19(3)17-12(6-8-15(20)21)5-7-14(22-4)16(13)17/h5-8,11H,9-10H2,1-4H3,(H,20,21) |
| InChIKey | VXSOFUURHVLAQL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|