About 3-(propylamino)pyrrole-2,5-dione
3-(propylamino)pyrrole-2,5-dione (PubChem CID 66927264) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-(propylamino)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-(propylamino)pyrrole-2,5-dione |
| PubChem CID | 66927264 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3-(propylamino)pyrrole-2,5-dione |
| SMILES | CCCNC1=CC(=O)NC1=O |
| InChI | InChI=1S/C7H10N2O2/c1-2-3-8-5-4-6(10)9-7(5)11/h4H,2-3H2,1H3,(H2,8,9,10,11) |
| InChIKey | HECANXYXPGCONM-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(propylamino)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(propylamino)pyrrole-2,5-dione?
The IUPAC name of 3-(propylamino)pyrrole-2,5-dione (CID 66927264) is 3-(propylamino)pyrrole-2,5-dione.
What is the SMILES notation for 3-(propylamino)pyrrole-2,5-dione?
The canonical SMILES for 3-(propylamino)pyrrole-2,5-dione is CCCNC1=CC(=O)NC1=O.
What is the InChIKey of 3-(propylamino)pyrrole-2,5-dione?
The InChIKey is HECANXYXPGCONM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-2-3-8-5-4-6(10)9-7(5)11/h4H,2-3H2,1H3,(H2,8,9,10,11).
What are the key properties of 3-(propylamino)pyrrole-2,5-dione?
3-(propylamino)pyrrole-2,5-dione has a molecular weight of 154.17 g/mol, XLogP of -0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propylamino)pyrrole-2,5-dione is sourced from PubChem (CID 66927264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).