C14H19N3O3 — CID 66927351
tert-butyl-[6-(2-oxopyrrolidin-1-yl)-3-pyridinyl]carbamic acid (PubChem CID 66927351) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is tert-butyl-[6-(2-oxopyrrolidin-1-yl)-3-pyridinyl]carbamic acid.
| Compound Name | tert-butyl-[6-(2-oxopyrrolidin-1-yl)-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 66927351 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | tert-butyl-[6-(2-oxopyrrolidin-1-yl)-3-pyridinyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1ccc(N2CCCC2=O)nc1 |
| InChI | InChI=1S/C14H19N3O3/c1-14(2,3)17(13(19)20)10-6-7-11(15-9-10)16-8-4-5-12(16)18/h6-7,9H,4-5,8H2,1-3H3,(H,19,20) |
| InChIKey | COBMFYDQRHIUJB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |