C20H28N6Si — CID 66927380
N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-piperidin-1-yl-5-(2-trimethylsilylethynyl)pyrimidin-4-amine (PubChem CID 66927380) has the molecular formula C20H28N6Si and a molecular weight of 380.57 g/mol. Its IUPAC name is N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-piperidin-1-yl-5-(2-trimethylsilylethynyl)pyrimidin-4-amine.
| Compound Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-piperidin-1-yl-5-(2-trimethylsilylethynyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66927380 |
| Molecular Formula | C20H28N6Si |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-piperidin-1-yl-5-(2-trimethylsilylethynyl)pyrimidin-4-amine |
| SMILES | C[Si](C)(C)C#Cc1cnc(N2CCCCC2)nc1Nc1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C20H28N6Si/c1-27(2,3)12-9-16-14-21-20(26-10-5-4-6-11-26)23-19(16)22-18-13-17(24-25-18)15-7-8-15/h13-15H,4-8,10-11H2,1-3H3,(H2,21,22,23,24,25) |
| InChIKey | COQMNGBXKKJFLR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|