About 1-benzylsulfonylazepane
1-benzylsulfonylazepane (PubChem CID 669274) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-benzylsulfonylazepane.
Molecular Properties
| Compound Name | 1-benzylsulfonylazepane |
| PubChem CID | 669274 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-benzylsulfonylazepane |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C13H19NO2S/c15-17(16,12-13-8-4-3-5-9-13)14-10-6-1-2-7-11-14/h3-5,8-9H,1-2,6-7,10-12H2 |
| InChIKey | CRWUIWIYBHVTQV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylsulfonylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylsulfonylazepane?
The IUPAC name of 1-benzylsulfonylazepane (CID 669274) is 1-benzylsulfonylazepane.
What is the SMILES notation for 1-benzylsulfonylazepane?
The canonical SMILES for 1-benzylsulfonylazepane is O=S(=O)(Cc1ccccc1)N1CCCCCC1.
What is the InChIKey of 1-benzylsulfonylazepane?
The InChIKey is CRWUIWIYBHVTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c15-17(16,12-13-8-4-3-5-9-13)14-10-6-1-2-7-11-14/h3-5,8-9H,1-2,6-7,10-12H2.
What are the key properties of 1-benzylsulfonylazepane?
1-benzylsulfonylazepane has a molecular weight of 253.37 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylsulfonylazepane is sourced from PubChem (CID 669274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).