C17H23N3O3 — CID 66927406
(8aR)-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-7-hydroxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine-3-carboxamide (PubChem CID 66927406) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (8aR)-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-7-hydroxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | (8aR)-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-7-hydroxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 66927406 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (8aR)-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-7-hydroxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCOc2ccccc21)C1CN2CC(O)C[C@@H]2CN1 |
| InChI | InChI=1S/C17H23N3O3/c21-12-7-11-8-18-15(10-20(11)9-12)17(22)19-14-5-6-23-16-4-2-1-3-13(14)16/h1-4,11-12,14-15,18,21H,5-10H2,(H,19,22)/t11-,12?,14-,15?/m1/s1 |
| InChIKey | VVCGPFXJBNVOCF-CDMIUOQYSA-N |
| XLogP | 0.03 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |