About 2-tributylstannylthiophene-3,4-dicarbonitrile
2-tributylstannylthiophene-3,4-dicarbonitrile (PubChem CID 66927436) has the molecular formula C18H28N2SSn
and a molecular weight of 423.21 g/mol. Its IUPAC name is 2-tributylstannylthiophene-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2-tributylstannylthiophene-3,4-dicarbonitrile |
| PubChem CID | 66927436 |
| Molecular Formula | C18H28N2SSn |
| Molecular Weight | 423.21 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-tributylstannylthiophene-3,4-dicarbonitrile |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1scc(C#N)c1C#N |
| InChI | InChI=1S/C6HN2S.3C4H9.Sn/c7-1-5-3-9-4-6(5)2-8;3*1-3-4-2;/h3H;3*1,3-4H2,2H3; |
| InChIKey | IFLFVEMSUYNRGE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.21 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tributylstannylthiophene-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tributylstannylthiophene-3,4-dicarbonitrile?
The IUPAC name of 2-tributylstannylthiophene-3,4-dicarbonitrile (CID 66927436) is 2-tributylstannylthiophene-3,4-dicarbonitrile.
What is the SMILES notation for 2-tributylstannylthiophene-3,4-dicarbonitrile?
The canonical SMILES for 2-tributylstannylthiophene-3,4-dicarbonitrile is CCCC[Sn](CCCC)(CCCC)c1scc(C#N)c1C#N.
What is the InChIKey of 2-tributylstannylthiophene-3,4-dicarbonitrile?
The InChIKey is IFLFVEMSUYNRGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HN2S.3C4H9.Sn/c7-1-5-3-9-4-6(5)2-8;3*1-3-4-2;/h3H;3*1,3-4H2,2H3;.
What are the key properties of 2-tributylstannylthiophene-3,4-dicarbonitrile?
2-tributylstannylthiophene-3,4-dicarbonitrile has a molecular weight of 423.21 g/mol, XLogP of 5.55, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tributylstannylthiophene-3,4-dicarbonitrile is sourced from PubChem (CID 66927436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).