C23H23F3N4O2 — CID 66928193
N-[3-(2-methylpyrazol-3-yl)-4-piperidin-4-yloxyphenyl]-4-(trifluoromethyl)benzamide (PubChem CID 66928193) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is N-[3-(2-methylpyrazol-3-yl)-4-piperidin-4-yloxyphenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(2-methylpyrazol-3-yl)-4-piperidin-4-yloxyphenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 66928193 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[3-(2-methylpyrazol-3-yl)-4-piperidin-4-yloxyphenyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cn1nccc1-c1cc(NC(=O)c2ccc(C(F)(F)F)cc2)ccc1OC1CCNCC1 |
| InChI | InChI=1S/C23H23F3N4O2/c1-30-20(10-13-28-30)19-14-17(6-7-21(19)32-18-8-11-27-12-9-18)29-22(31)15-2-4-16(5-3-15)23(24,25)26/h2-7,10,13-14,18,27H,8-9,11-12H2,1H3,(H,29,31) |
| InChIKey | NCNLVPQKCBPIID-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |