About 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine
1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine (PubChem CID 66928481) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine.
Molecular Properties
| Compound Name | 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine |
| PubChem CID | 66928481 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine |
| SMILES | CC1(CCCCn2ccc(N)n2)OCCO1 |
| InChI | InChI=1S/C11H19N3O2/c1-11(15-8-9-16-11)5-2-3-6-14-7-4-10(12)13-14/h4,7H,2-3,5-6,8-9H2,1H3,(H2,12,13) |
| InChIKey | HYXJQWFPWHPSEV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine?
The IUPAC name of 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine (CID 66928481) is 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine.
What is the SMILES notation for 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine?
The canonical SMILES for 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine is CC1(CCCCn2ccc(N)n2)OCCO1.
What is the InChIKey of 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine?
The InChIKey is HYXJQWFPWHPSEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-11(15-8-9-16-11)5-2-3-6-14-7-4-10(12)13-14/h4,7H,2-3,5-6,8-9H2,1H3,(H2,12,13).
What are the key properties of 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine?
1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine has a molecular weight of 225.29 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-methyl-1,3-dioxolan-2-yl)butyl]pyrazol-3-amine is sourced from PubChem (CID 66928481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).