About (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate
(2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate (PubChem CID 66928695) has the molecular formula C19H17ClN4O3
and a molecular weight of 384.82 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate |
| PubChem CID | 66928695 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate |
| SMILES | CC(=O)c1cccc(Cn2cc(NC(=O)OCc3ccccc3Cl)cn2)n1 |
| InChI | InChI=1S/C19H17ClN4O3/c1-13(25)18-8-4-6-15(22-18)10-24-11-16(9-21-24)23-19(26)27-12-14-5-2-3-7-17(14)20/h2-9,11H,10,12H2,1H3,(H,23,26) |
| InChIKey | PFTRSXVAVYLKFS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate?
The IUPAC name of (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate (CID 66928695) is (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate.
What is the SMILES notation for (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate?
The canonical SMILES for (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate is CC(=O)c1cccc(Cn2cc(NC(=O)OCc3ccccc3Cl)cn2)n1.
What is the InChIKey of (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate?
The InChIKey is PFTRSXVAVYLKFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN4O3/c1-13(25)18-8-4-6-15(22-18)10-24-11-16(9-21-24)23-19(26)27-12-14-5-2-3-7-17(14)20/h2-9,11H,10,12H2,1H3,(H,23,26).
What are the key properties of (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate?
(2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate has a molecular weight of 384.82 g/mol, XLogP of 3.93, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl N-[1-[(6-acetyl-2-pyridinyl)methyl]pyrazol-4-yl]carbamate is sourced from PubChem (CID 66928695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).