About 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole
1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole (PubChem CID 66928757) has the molecular formula C10H9F2N3O3
and a molecular weight of 257.20 g/mol. Its IUPAC name is 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole.
Molecular Properties
| Compound Name | 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole |
| PubChem CID | 66928757 |
| Molecular Formula | C10H9F2N3O3 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole |
| SMILES | CC(F)(F)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1 |
| InChI | InChI=1S/C10H9F2N3O3/c1-10(11,12)9-3-2-8(18-9)6-14-5-7(4-13-14)15(16)17/h2-5H,6H2,1H3 |
| InChIKey | WTZCIXUBAMVVMZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole?
The IUPAC name of 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole (CID 66928757) is 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole.
What is the SMILES notation for 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole?
The canonical SMILES for 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole is CC(F)(F)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1.
What is the InChIKey of 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole?
The InChIKey is WTZCIXUBAMVVMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2N3O3/c1-10(11,12)9-3-2-8(18-9)6-14-5-7(4-13-14)15(16)17/h2-5H,6H2,1H3.
What are the key properties of 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole?
1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole has a molecular weight of 257.20 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]-4-nitropyrazole is sourced from PubChem (CID 66928757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).