About CID 66928953
CID 66928953 (PubChem CID 66928953) has the molecular formula C10H5F3LiN2O3
and a molecular weight of 265.10 g/mol.
Molecular Properties
| Compound Name | CID 66928953 |
| PubChem CID | 66928953 |
| Molecular Formula | C10H5F3LiN2O3 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ncoc1-c1cccc(C(F)(F)F)n1.[Li] |
| InChI | InChI=1S/C10H5F3N2O3.Li/c11-10(12,13)6-3-1-2-5(15-6)8-7(9(16)17)14-4-18-8;/h1-4H,(H,16,17); |
| InChIKey | CZLSCUQWGRPOCY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 66928953 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66928953?
The IUPAC name of CID 66928953 (CID 66928953) is not available.
What is the SMILES notation for CID 66928953?
The canonical SMILES for CID 66928953 is O=C(O)c1ncoc1-c1cccc(C(F)(F)F)n1.[Li].
What is the InChIKey of CID 66928953?
The InChIKey is CZLSCUQWGRPOCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3N2O3.Li/c11-10(12,13)6-3-1-2-5(15-6)8-7(9(16)17)14-4-18-8;/h1-4H,(H,16,17);.
What are the key properties of CID 66928953?
CID 66928953 has a molecular weight of 265.10 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66928953 is sourced from PubChem (CID 66928953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).