About lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate
lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate (PubChem CID 66928955) has the molecular formula C10H4F3LiN2O3
and a molecular weight of 264.09 g/mol. Its IUPAC name is lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate |
| PubChem CID | 66928955 |
| Molecular Formula | C10H4F3LiN2O3 |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate |
| SMILES | O=C([O-])c1ncoc1-c1cccc(C(F)(F)F)n1.[Li+] |
| InChI | InChI=1S/C10H5F3N2O3.Li/c11-10(12,13)6-3-1-2-5(15-6)8-7(9(16)17)14-4-18-8;/h1-4H,(H,16,17);/q;+1/p-1 |
| InChIKey | UJSDJTDBJYQYIB-UHFFFAOYSA-M |
| XLogP | -1.88 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate?
The IUPAC name of lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate (CID 66928955) is lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate.
What is the SMILES notation for lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate?
The canonical SMILES for lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate is O=C([O-])c1ncoc1-c1cccc(C(F)(F)F)n1.[Li+].
What is the InChIKey of lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate?
The InChIKey is UJSDJTDBJYQYIB-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H5F3N2O3.Li/c11-10(12,13)6-3-1-2-5(15-6)8-7(9(16)17)14-4-18-8;/h1-4H,(H,16,17);/q;+1/p-1.
What are the key properties of lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate?
lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate has a molecular weight of 264.09 g/mol, XLogP of -1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 5-[6-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 66928955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).