5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid

C13H13NO3 — CID 66929104

IUPAC5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid
SMILESCc1ccc(C)c(-c2oc(C)nc2C(=O)O)c1
InChIInChI=1S/C13H13NO3/c1-7-4-5-8(2)10(6-7)12-11(13(15)16)14-9(3)17-12/h4-6H,1-3H3,(H,15,16)
InChIKeyCEFZXFAWBCHSLD-UHFFFAOYSA-N
MW231.25 g/mol
LogP2.97
Rot. Bonds2

About 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid

5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid (PubChem CID 66929104) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid
PubChem CID66929104
Molecular FormulaC13H13NO3
Molecular Weight231.25 g/mol
Exact Mass231.09
IUPAC Name5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid
SMILESCc1ccc(C)c(-c2oc(C)nc2C(=O)O)c1
InChIInChI=1S/C13H13NO3/c1-7-4-5-8(2)10(6-7)12-11(13(15)16)14-9(3)17-12/h4-6H,1-3H3,(H,15,16)
InChIKeyCEFZXFAWBCHSLD-UHFFFAOYSA-N
XLogP2.97
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 52.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid (CID 66929104) is 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid is Cc1ccc(C)c(-c2oc(C)nc2C(=O)O)c1.
What is the InChIKey of 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid?
The InChIKey is CEFZXFAWBCHSLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-7-4-5-8(2)10(6-7)12-11(13(15)16)14-9(3)17-12/h4-6H,1-3H3,(H,15,16).
What are the key properties of 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid?
5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid has a molecular weight of 231.25 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dimethylphenyl)-2-methyl-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 66929104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).