C13H20BrNO3S2 — CID 66929991
5-bromo-N-[(3S,4R,5R)-5-hydroxy-3-methyloct-7-en-4-yl]thiophene-2-sulfonamide (PubChem CID 66929991) has the molecular formula C13H20BrNO3S2 and a molecular weight of 382.35 g/mol. Its IUPAC name is 5-bromo-N-[(3S,4R,5R)-5-hydroxy-3-methyloct-7-en-4-yl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(3S,4R,5R)-5-hydroxy-3-methyloct-7-en-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66929991 |
| Molecular Formula | C13H20BrNO3S2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 5-bromo-N-[(3S,4R,5R)-5-hydroxy-3-methyloct-7-en-4-yl]thiophene-2-sulfonamide |
| SMILES | C=CC[C@@H](O)[C@H](NS(=O)(=O)c1ccc(Br)s1)[C@@H](C)CC |
| InChI | InChI=1S/C13H20BrNO3S2/c1-4-6-10(16)13(9(3)5-2)15-20(17,18)12-8-7-11(14)19-12/h4,7-10,13,15-16H,1,5-6H2,2-3H3/t9-,10+,13+/m0/s1 |
| InChIKey | WRAUFQUOSKWGAQ-OPQQBVKSSA-N |
| XLogP | 3.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|