C22H26FN5O2S — CID 66930624
(5R,7S)-1-(3-fluorophenyl)-8-(1H-indazol-5-ylmethyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide (PubChem CID 66930624) has the molecular formula C22H26FN5O2S and a molecular weight of 443.55 g/mol. Its IUPAC name is (5R,7S)-1-(3-fluorophenyl)-8-(1H-indazol-5-ylmethyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide.
| Compound Name | (5R,7S)-1-(3-fluorophenyl)-8-(1H-indazol-5-ylmethyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
|---|---|
| PubChem CID | 66930624 |
| Molecular Formula | C22H26FN5O2S |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (5R,7S)-1-(3-fluorophenyl)-8-(1H-indazol-5-ylmethyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1ccc3[nH]ncc3c1)CN(C)S(=O)(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C22H26FN5O2S/c1-16-12-22(8-9-27(16)14-17-6-7-21-18(10-17)13-24-25-21)15-26(2)31(29,30)28(22)20-5-3-4-19(23)11-20/h3-7,10-11,13,16H,8-9,12,14-15H2,1-2H3,(H,24,25)/t16-,22+/m0/s1 |
| InChIKey | CDUIMNUZNXCHKX-KSFYIVLOSA-N |
| XLogP | 3.12 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |