About 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate
4H-furo[3,2-b]pyrrol-2-ylmethyl acetate (PubChem CID 66930864) has the molecular formula C9H9NO3
and a molecular weight of 179.17 g/mol. Its IUPAC name is 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate.
Molecular Properties
| Compound Name | 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate |
| PubChem CID | 66930864 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate |
| SMILES | CC(=O)OCc1cc2[nH]ccc2o1 |
| InChI | InChI=1S/C9H9NO3/c1-6(11)12-5-7-4-8-9(13-7)2-3-10-8/h2-4,10H,5H2,1H3 |
| InChIKey | BTAPIDVMVPBMDJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate?
The IUPAC name of 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate (CID 66930864) is 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate.
What is the SMILES notation for 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate?
The canonical SMILES for 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate is CC(=O)OCc1cc2[nH]ccc2o1.
What is the InChIKey of 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate?
The InChIKey is BTAPIDVMVPBMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c1-6(11)12-5-7-4-8-9(13-7)2-3-10-8/h2-4,10H,5H2,1H3.
What are the key properties of 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate?
4H-furo[3,2-b]pyrrol-2-ylmethyl acetate has a molecular weight of 179.17 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-furo[3,2-b]pyrrol-2-ylmethyl acetate is sourced from PubChem (CID 66930864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).