About [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol
[3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol (PubChem CID 66931102) has the molecular formula C18H15FN4O3
and a molecular weight of 354.34 g/mol. Its IUPAC name is [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol |
| PubChem CID | 66931102 |
| Molecular Formula | C18H15FN4O3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol |
| SMILES | OCc1cccc(Nc2nccc(Nc3c(F)ccc4c3OCO4)n2)c1 |
| InChI | InChI=1S/C18H15FN4O3/c19-13-4-5-14-17(26-10-25-14)16(13)22-15-6-7-20-18(23-15)21-12-3-1-2-11(8-12)9-24/h1-8,24H,9-10H2,(H2,20,21,22,23) |
| InChIKey | LGTYFIGAEOXNJM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol?
The IUPAC name of [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol (CID 66931102) is [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol.
What is the SMILES notation for [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol?
The canonical SMILES for [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol is OCc1cccc(Nc2nccc(Nc3c(F)ccc4c3OCO4)n2)c1.
What is the InChIKey of [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol?
The InChIKey is LGTYFIGAEOXNJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN4O3/c19-13-4-5-14-17(26-10-25-14)16(13)22-15-6-7-20-18(23-15)21-12-3-1-2-11(8-12)9-24/h1-8,24H,9-10H2,(H2,20,21,22,23).
What are the key properties of [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol?
[3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol has a molecular weight of 354.34 g/mol, XLogP of 3.32, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]methanol is sourced from PubChem (CID 66931102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).