C12H25N3O2S — CID 66931365
(5R,7S)-7-methyl-1-pentyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide (PubChem CID 66931365) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is (5R,7S)-7-methyl-1-pentyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide.
| Compound Name | (5R,7S)-7-methyl-1-pentyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
|---|---|
| PubChem CID | 66931365 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (5R,7S)-7-methyl-1-pentyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
| SMILES | CCCCCN1[C@@]2(CCN[C@@H](C)C2)CNS1(=O)=O |
| InChI | InChI=1S/C12H25N3O2S/c1-3-4-5-8-15-12(10-14-18(15,16)17)6-7-13-11(2)9-12/h11,13-14H,3-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | AAKKCTRANFLNME-NWDGAFQWSA-N |
| XLogP | 0.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|