About 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol
2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol (PubChem CID 66931563) has the molecular formula C19H17FN4O3
and a molecular weight of 368.37 g/mol. Its IUPAC name is 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol |
| PubChem CID | 66931563 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol |
| SMILES | OCCc1ccc(Nc2nccc(Nc3c(F)ccc4c3OCO4)n2)cc1 |
| InChI | InChI=1S/C19H17FN4O3/c20-14-5-6-15-18(27-11-26-15)17(14)23-16-7-9-21-19(24-16)22-13-3-1-12(2-4-13)8-10-25/h1-7,9,25H,8,10-11H2,(H2,21,22,23,24) |
| InChIKey | MAVJIRZHKTZNMS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol?
The IUPAC name of 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol (CID 66931563) is 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol.
What is the SMILES notation for 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol?
The canonical SMILES for 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol is OCCc1ccc(Nc2nccc(Nc3c(F)ccc4c3OCO4)n2)cc1.
What is the InChIKey of 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol?
The InChIKey is MAVJIRZHKTZNMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN4O3/c20-14-5-6-15-18(27-11-26-15)17(14)23-16-7-9-21-19(24-16)22-13-3-1-12(2-4-13)8-10-25/h1-7,9,25H,8,10-11H2,(H2,21,22,23,24).
What are the key properties of 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol?
2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol has a molecular weight of 368.37 g/mol, XLogP of 3.37, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[4-[(5-fluoro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanol is sourced from PubChem (CID 66931563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).