C30H39NO3 — CID 66931593
(8S,13S,14S)-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 66931593) has the molecular formula C30H39NO3 and a molecular weight of 461.65 g/mol. Its IUPAC name is (8S,13S,14S)-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,13S,14S)-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 66931593 |
| Molecular Formula | C30H39NO3 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | (8S,13S,14S)-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CCN(CC)CCOc1ccc(C2=C3C4=C(CC[C@H]3[C@@H]3CCC(=O)[C@@]3(C)C2)CC(=O)CC4)cc1 |
| InChI | InChI=1S/C30H39NO3/c1-4-31(5-2)16-17-34-23-10-6-20(7-11-23)26-19-30(3)27(14-15-28(30)33)25-12-8-21-18-22(32)9-13-24(21)29(25)26/h6-7,10-11,25,27H,4-5,8-9,12-19H2,1-3H3/t25-,27-,30-/m0/s1 |
| InChIKey | IZKKSTFHTWHNPF-XXJPWZBZSA-N |
| XLogP | 6.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |