C19H29NO6 — CID 66931951
tert-butyl 3-ethyl-4-[(2R)-2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-5-methylbenzoate (PubChem CID 66931951) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is tert-butyl 3-ethyl-4-[(2R)-2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-5-methylbenzoate.
| Compound Name | tert-butyl 3-ethyl-4-[(2R)-2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-5-methylbenzoate |
|---|---|
| PubChem CID | 66931951 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | tert-butyl 3-ethyl-4-[(2R)-2-hydroxy-3-[(2-hydroxyacetyl)amino]propoxy]-5-methylbenzoate |
| SMILES | CCc1cc(C(=O)OC(C)(C)C)cc(C)c1OC[C@H](O)CNC(=O)CO |
| InChI | InChI=1S/C19H29NO6/c1-6-13-8-14(18(24)26-19(3,4)5)7-12(2)17(13)25-11-15(22)9-20-16(23)10-21/h7-8,15,21-22H,6,9-11H2,1-5H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | FDMSNKIJTIPWKJ-OAHLLOKOSA-N |
| XLogP | 1.36 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |