C22H28F3N5O2 — CID 66932277
8-methyl-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide (PubChem CID 66932277) has the molecular formula C22H28F3N5O2 and a molecular weight of 451.49 g/mol. Its IUPAC name is 8-methyl-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide.
| Compound Name | 8-methyl-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 66932277 |
| Molecular Formula | C22H28F3N5O2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 8-methyl-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
| SMILES | CNC(=O)C(CC(C)C)NC(=O)c1nc(-c2cc(F)c(F)cc2F)n2c1CN(C)CCC2 |
| InChI | InChI=1S/C22H28F3N5O2/c1-12(2)8-17(21(31)26-3)27-22(32)19-18-11-29(4)6-5-7-30(18)20(28-19)13-9-15(24)16(25)10-14(13)23/h9-10,12,17H,5-8,11H2,1-4H3,(H,26,31)(H,27,32) |
| InChIKey | MEYZPLWPQAKZRJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|