C26H27NO5S — CID 66932379
2-[(4-methylphenyl)sulfonylamino]-2-[(2S,3R,5R)-5-naphthalen-2-yl-2-prop-2-enyloxolan-3-yl]acetic acid (PubChem CID 66932379) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-2-[(2S,3R,5R)-5-naphthalen-2-yl-2-prop-2-enyloxolan-3-yl]acetic acid.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-2-[(2S,3R,5R)-5-naphthalen-2-yl-2-prop-2-enyloxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 66932379 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-2-[(2S,3R,5R)-5-naphthalen-2-yl-2-prop-2-enyloxolan-3-yl]acetic acid |
| SMILES | C=CC[C@@H]1O[C@@H](c2ccc3ccccc3c2)C[C@@H]1C(NS(=O)(=O)c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C26H27NO5S/c1-3-6-23-22(16-24(32-23)20-12-11-18-7-4-5-8-19(18)15-20)25(26(28)29)27-33(30,31)21-13-9-17(2)10-14-21/h3-5,7-15,22-25,27H,1,6,16H2,2H3,(H,28,29)/t22-,23-,24+,25?/m0/s1 |
| InChIKey | VUETXGNTCYORPI-YTGPUZKVSA-N |
| XLogP | 4.60 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|