C27H32FN5O4S — CID 66932563
N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-(4-fluorophenyl)sulfonyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide (PubChem CID 66932563) has the molecular formula C27H32FN5O4S and a molecular weight of 541.65 g/mol. Its IUPAC name is N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-(4-fluorophenyl)sulfonyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide.
| Compound Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-(4-fluorophenyl)sulfonyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 66932563 |
| Molecular Formula | C27H32FN5O4S |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-(4-fluorophenyl)sulfonyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
| SMILES | CNC(=O)C(NC(=O)c1nc(-c2ccccc2)n2c1CN(S(=O)(=O)c1ccc(F)cc1)CCC2)C(C)(C)C |
| InChI | InChI=1S/C27H32FN5O4S/c1-27(2,3)23(26(35)29-4)31-25(34)22-21-17-32(38(36,37)20-13-11-19(28)12-14-20)15-8-16-33(21)24(30-22)18-9-6-5-7-10-18/h5-7,9-14,23H,8,15-17H2,1-4H3,(H,29,35)(H,31,34) |
| InChIKey | MSPQABUJHJNCKK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |