About 3,7a-dihydro-2H-furo[2,3-b]pyran
3,7a-dihydro-2H-furo[2,3-b]pyran (PubChem CID 66932579) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 3,7a-dihydro-2H-furo[2,3-b]pyran.
Molecular Properties
| Compound Name | 3,7a-dihydro-2H-furo[2,3-b]pyran |
| PubChem CID | 66932579 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 3,7a-dihydro-2H-furo[2,3-b]pyran |
| SMILES | C1=COC2OCCC2=C1 |
| InChI | InChI=1S/C7H8O2/c1-2-6-3-5-9-7(6)8-4-1/h1-2,4,7H,3,5H2 |
| InChIKey | MMRUQUNSWVWFDM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,7a-dihydro-2H-furo[2,3-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7a-dihydro-2H-furo[2,3-b]pyran?
The IUPAC name of 3,7a-dihydro-2H-furo[2,3-b]pyran (CID 66932579) is 3,7a-dihydro-2H-furo[2,3-b]pyran.
What is the SMILES notation for 3,7a-dihydro-2H-furo[2,3-b]pyran?
The canonical SMILES for 3,7a-dihydro-2H-furo[2,3-b]pyran is C1=COC2OCCC2=C1.
What is the InChIKey of 3,7a-dihydro-2H-furo[2,3-b]pyran?
The InChIKey is MMRUQUNSWVWFDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-2-6-3-5-9-7(6)8-4-1/h1-2,4,7H,3,5H2.
What are the key properties of 3,7a-dihydro-2H-furo[2,3-b]pyran?
3,7a-dihydro-2H-furo[2,3-b]pyran has a molecular weight of 124.14 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7a-dihydro-2H-furo[2,3-b]pyran is sourced from PubChem (CID 66932579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).