C21H23Cl2NO5 — CID 66933005
(E)-2-[8-(cyclopropylmethyl)-3-(3,4-dichlorophenoxy)-8-azabicyclo[3.2.1]octan-1-yl]but-2-enedioic acid (PubChem CID 66933005) has the molecular formula C21H23Cl2NO5 and a molecular weight of 440.32 g/mol. Its IUPAC name is (E)-2-[8-(cyclopropylmethyl)-3-(3,4-dichlorophenoxy)-8-azabicyclo[3.2.1]octan-1-yl]but-2-enedioic acid.
| Compound Name | (E)-2-[8-(cyclopropylmethyl)-3-(3,4-dichlorophenoxy)-8-azabicyclo[3.2.1]octan-1-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 66933005 |
| Molecular Formula | C21H23Cl2NO5 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (E)-2-[8-(cyclopropylmethyl)-3-(3,4-dichlorophenoxy)-8-azabicyclo[3.2.1]octan-1-yl]but-2-enedioic acid |
| SMILES | O=C(O)/C=C(/C(=O)O)C12CCC(CC(Oc3ccc(Cl)c(Cl)c3)C1)N2CC1CC1 |
| InChI | InChI=1S/C21H23Cl2NO5/c22-17-4-3-14(8-18(17)23)29-15-7-13-5-6-21(10-15,24(13)11-12-1-2-12)16(20(27)28)9-19(25)26/h3-4,8-9,12-13,15H,1-2,5-7,10-11H2,(H,25,26)(H,27,28)/b16-9- |
| InChIKey | LRNWGTCVTZEAPQ-SXGWCWSVSA-N |
| XLogP | 4.24 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|