C17H19ClN4O2S2 — CID 66933476
5-(benzenesulfonyl)-8-methyl-4-methylsulfanyl-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene;hydrochloride (PubChem CID 66933476) has the molecular formula C17H19ClN4O2S2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-8-methyl-4-methylsulfanyl-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene;hydrochloride.
| Compound Name | 5-(benzenesulfonyl)-8-methyl-4-methylsulfanyl-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene;hydrochloride |
|---|---|
| PubChem CID | 66933476 |
| Molecular Formula | C17H19ClN4O2S2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 5-(benzenesulfonyl)-8-methyl-4-methylsulfanyl-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene;hydrochloride |
| SMILES | CSc1nn2c3c(c(C)nc2c1S(=O)(=O)c1ccccc1)CCNC3.Cl |
| InChI | InChI=1S/C17H18N4O2S2.ClH/c1-11-13-8-9-18-10-14(13)21-16(19-11)15(17(20-21)24-2)25(22,23)12-6-4-3-5-7-12;/h3-7,18H,8-10H2,1-2H3;1H |
| InChIKey | KIWFBDWJNBJZFO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |