About CID 66933494
CID 66933494 (PubChem CID 66933494) has the molecular formula C33H40N4O3SSi
and a molecular weight of 600.86 g/mol.
Molecular Properties
| Compound Name | CID 66933494 |
| PubChem CID | 66933494 |
| Molecular Formula | C33H40N4O3SSi |
| Molecular Weight | 600.86 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | — |
| SMILES | CC/N=C(\NS(=O)(=O)c1ccc(C(O[Si]C(C)(C)C)(c2ccccc2)c2ccccc2)cc1)N1CC2(C=N1)CCCC2 |
| InChI | InChI=1S/C33H40N4O3SSi/c1-5-34-30(37-25-32(24-35-37)22-12-13-23-32)36-41(38,39)29-20-18-28(19-21-29)33(40-42-31(2,3)4,26-14-8-6-9-15-26)27-16-10-7-11-17-27/h6-11,14-21,24H,5,12-13,22-23,25H2,1-4H3,(H,34,36) |
| InChIKey | LWXBCQQQKPJZQN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.86 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 66933494 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66933494?
The IUPAC name of CID 66933494 (CID 66933494) is not available.
What is the SMILES notation for CID 66933494?
The canonical SMILES for CID 66933494 is CC/N=C(\NS(=O)(=O)c1ccc(C(O[Si]C(C)(C)C)(c2ccccc2)c2ccccc2)cc1)N1CC2(C=N1)CCCC2.
What is the InChIKey of CID 66933494?
The InChIKey is LWXBCQQQKPJZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H40N4O3SSi/c1-5-34-30(37-25-32(24-35-37)22-12-13-23-32)36-41(38,39)29-20-18-28(19-21-29)33(40-42-31(2,3)4,26-14-8-6-9-15-26)27-16-10-7-11-17-27/h6-11,14-21,24H,5,12-13,22-23,25H2,1-4H3,(H,34,36).
What are the key properties of CID 66933494?
CID 66933494 has a molecular weight of 600.86 g/mol, XLogP of 6.35, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66933494 is sourced from PubChem (CID 66933494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).