C26H34FNO5 — CID 66934043
5-[3-(diethylamino)propyl]-6-(4-fluorophenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid (PubChem CID 66934043) has the molecular formula C26H34FNO5 and a molecular weight of 459.56 g/mol. Its IUPAC name is 5-[3-(diethylamino)propyl]-6-(4-fluorophenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid.
| Compound Name | 5-[3-(diethylamino)propyl]-6-(4-fluorophenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid |
|---|---|
| PubChem CID | 66934043 |
| Molecular Formula | C26H34FNO5 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 5-[3-(diethylamino)propyl]-6-(4-fluorophenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid |
| SMILES | CCN(CC)CCCC1(O)c2ccccc2CCCC1c1ccc(F)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H32FNO.C2H2O4/c1-3-26(4-2)18-8-17-24(27)22-11-6-5-9-19(22)10-7-12-23(24)20-13-15-21(25)16-14-20;3-1(4)2(5)6/h5-6,9,11,13-16,23,27H,3-4,7-8,10,12,17-18H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | XIEWNCTWKGDDMB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|