C24H29F2NO5 — CID 66934100
(5R,6R)-6-(2,4-difluorophenyl)-5-[3-(dimethylamino)propyl]-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid (PubChem CID 66934100) has the molecular formula C24H29F2NO5 and a molecular weight of 449.49 g/mol. Its IUPAC name is (5R,6R)-6-(2,4-difluorophenyl)-5-[3-(dimethylamino)propyl]-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid.
| Compound Name | (5R,6R)-6-(2,4-difluorophenyl)-5-[3-(dimethylamino)propyl]-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid |
|---|---|
| PubChem CID | 66934100 |
| Molecular Formula | C24H29F2NO5 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (5R,6R)-6-(2,4-difluorophenyl)-5-[3-(dimethylamino)propyl]-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid |
| SMILES | CN(C)CCC[C@]1(O)c2ccccc2CCC[C@@H]1c1ccc(F)cc1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H27F2NO.C2H2O4/c1-25(2)14-6-13-22(26)19-9-4-3-7-16(19)8-5-10-20(22)18-12-11-17(23)15-21(18)24;3-1(4)2(5)6/h3-4,7,9,11-12,15,20,26H,5-6,8,10,13-14H2,1-2H3;(H,3,4)(H,5,6)/t20-,22+;/m1./s1 |
| InChIKey | PEAZCEPQHKFEPE-LBPAWUGGSA-N |
| XLogP | 3.77 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|