C22H26N4O4 — CID 66934139
benzene-1,4-dicarboxamide;3-methyl-4-(piperidine-1-carbonyl)benzamide (PubChem CID 66934139) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is benzene-1,4-dicarboxamide;3-methyl-4-(piperidine-1-carbonyl)benzamide.
| Compound Name | benzene-1,4-dicarboxamide;3-methyl-4-(piperidine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 66934139 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | benzene-1,4-dicarboxamide;3-methyl-4-(piperidine-1-carbonyl)benzamide |
| SMILES | Cc1cc(C(N)=O)ccc1C(=O)N1CCCCC1.NC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H18N2O2.C8H8N2O2/c1-10-9-11(13(15)17)5-6-12(10)14(18)16-7-3-2-4-8-16;9-7(11)5-1-2-6(4-3-5)8(10)12/h5-6,9H,2-4,7-8H2,1H3,(H2,15,17);1-4H,(H2,9,11)(H2,10,12) |
| InChIKey | KIHLBBXRMNRRDQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |