About ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate
ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate (PubChem CID 66934628) has the molecular formula C13H12INO4
and a molecular weight of 373.15 g/mol. Its IUPAC name is ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate |
| PubChem CID | 66934628 |
| Molecular Formula | C13H12INO4 |
| Molecular Weight | 373.15 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate |
| SMILES | CCOC(=O)C1CC(=O)Nc2ccc(I)cc2C1=O |
| InChI | InChI=1S/C13H12INO4/c1-2-19-13(18)9-6-11(16)15-10-4-3-7(14)5-8(10)12(9)17/h3-5,9H,2,6H2,1H3,(H,15,16) |
| InChIKey | ACCZWCBEPJDFNK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate?
The IUPAC name of ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate (CID 66934628) is ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate.
What is the SMILES notation for ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate?
The canonical SMILES for ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate is CCOC(=O)C1CC(=O)Nc2ccc(I)cc2C1=O.
What is the InChIKey of ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate?
The InChIKey is ACCZWCBEPJDFNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12INO4/c1-2-19-13(18)9-6-11(16)15-10-4-3-7(14)5-8(10)12(9)17/h3-5,9H,2,6H2,1H3,(H,15,16).
What are the key properties of ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate?
ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate has a molecular weight of 373.15 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-iodo-2,5-dioxo-3,4-dihydro-1H-1-benzazepine-4-carboxylate is sourced from PubChem (CID 66934628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).