C26H31ClN2O6S — CID 66935486
2-[[2-benzyl-3-[(4-chlorophenyl)sulfonylamino]-3-oxopropyl]-but-3-enoylamino]-3,3-dimethylbutanoic acid (PubChem CID 66935486) has the molecular formula C26H31ClN2O6S and a molecular weight of 535.06 g/mol. Its IUPAC name is 2-[[2-benzyl-3-[(4-chlorophenyl)sulfonylamino]-3-oxopropyl]-but-3-enoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[[2-benzyl-3-[(4-chlorophenyl)sulfonylamino]-3-oxopropyl]-but-3-enoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 66935486 |
| Molecular Formula | C26H31ClN2O6S |
| Molecular Weight | 535.06 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 2-[[2-benzyl-3-[(4-chlorophenyl)sulfonylamino]-3-oxopropyl]-but-3-enoylamino]-3,3-dimethylbutanoic acid |
| SMILES | C=CCC(=O)N(CC(Cc1ccccc1)C(=O)NS(=O)(=O)c1ccc(Cl)cc1)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C26H31ClN2O6S/c1-5-9-22(30)29(23(25(32)33)26(2,3)4)17-19(16-18-10-7-6-8-11-18)24(31)28-36(34,35)21-14-12-20(27)13-15-21/h5-8,10-15,19,23H,1,9,16-17H2,2-4H3,(H,28,31)(H,32,33) |
| InChIKey | LYDCRDWXCCPLHU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.06 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|