About [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine
[6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine (PubChem CID 66935927) has the molecular formula C11H19FN6
and a molecular weight of 254.31 g/mol. Its IUPAC name is [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine |
| PubChem CID | 66935927 |
| Molecular Formula | C11H19FN6 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(NN)c(F)c(N2CCN(C)C[C@@H]2C)n1 |
| InChI | InChI=1S/C11H19FN6/c1-7-6-17(3)4-5-18(7)11-9(12)10(16-13)14-8(2)15-11/h7H,4-6,13H2,1-3H3,(H,14,15,16)/t7-/m0/s1 |
| InChIKey | LODWGLCVPSEUGB-ZETCQYMHSA-N |
| XLogP | 0.35 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine?
The IUPAC name of [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine (CID 66935927) is [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine.
What is the SMILES notation for [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine?
The canonical SMILES for [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine is Cc1nc(NN)c(F)c(N2CCN(C)C[C@@H]2C)n1.
What is the InChIKey of [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine?
The InChIKey is LODWGLCVPSEUGB-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H19FN6/c1-7-6-17(3)4-5-18(7)11-9(12)10(16-13)14-8(2)15-11/h7H,4-6,13H2,1-3H3,(H,14,15,16)/t7-/m0/s1.
What are the key properties of [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine?
[6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine has a molecular weight of 254.31 g/mol, XLogP of 0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(2S)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-methylpyrimidin-4-yl]hydrazine is sourced from PubChem (CID 66935927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).