About 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione
3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 66936121) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione.
Analyze 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione?
The IUPAC name of 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione (CID 66936121) is 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione.
What is the SMILES notation for 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione?
The canonical SMILES for 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione is O=C1NCC(=O)N2CCCC=C12.
What is the InChIKey of 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione?
The InChIKey is NROCWFOSMHATNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c11-7-5-9-8(12)6-3-1-2-4-10(6)7/h3H,1-2,4-5H2,(H,9,12).
What are the key properties of 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione?
3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione has a molecular weight of 166.18 g/mol, XLogP of -0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6,7,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione is sourced from PubChem (CID 66936121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).